C17H29N3O4 — CID 120539809
1-[[2-(cyclohexylcarbamoylamino)acetyl]-methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120539809) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[[2-(cyclohexylcarbamoylamino)acetyl]-methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[2-(cyclohexylcarbamoylamino)acetyl]-methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120539809 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 1-[[2-(cyclohexylcarbamoylamino)acetyl]-methylamino]cyclohexane-1-carboxylic acid |
| SMILES | CN(C(=O)CNC(=O)NC1CCCCC1)C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C17H29N3O4/c1-20(17(15(22)23)10-6-3-7-11-17)14(21)12-18-16(24)19-13-8-4-2-5-9-13/h13H,2-12H2,1H3,(H,22,23)(H2,18,19,24) |
| InChIKey | FITZRONLJPAXPN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |