C14H29N3O3S — CID 113068057
1-[2-[tert-butyl(methylsulfonyl)amino]ethyl]-3-cyclohexylurea (PubChem CID 113068057) has the molecular formula C14H29N3O3S and a molecular weight of 319.47 g/mol. Its IUPAC name is 1-[2-[tert-butyl(methylsulfonyl)amino]ethyl]-3-cyclohexylurea.
| Compound Name | 1-[2-[tert-butyl(methylsulfonyl)amino]ethyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 113068057 |
| Molecular Formula | C14H29N3O3S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-[2-[tert-butyl(methylsulfonyl)amino]ethyl]-3-cyclohexylurea |
| SMILES | CC(C)(C)N(CCNC(=O)NC1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C14H29N3O3S/c1-14(2,3)17(21(4,19)20)11-10-15-13(18)16-12-8-6-5-7-9-12/h12H,5-11H2,1-4H3,(H2,15,16,18) |
| InChIKey | RJPZWGRKWFULDQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |