C15H31N3O3S — CID 113068249
1-cyclohexyl-3-[2-[3-methylbutyl(methylsulfonyl)amino]ethyl]urea (PubChem CID 113068249) has the molecular formula C15H31N3O3S and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-[3-methylbutyl(methylsulfonyl)amino]ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-[3-methylbutyl(methylsulfonyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 113068249 |
| Molecular Formula | C15H31N3O3S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 1-cyclohexyl-3-[2-[3-methylbutyl(methylsulfonyl)amino]ethyl]urea |
| SMILES | CC(C)CCN(CCNC(=O)NC1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C15H31N3O3S/c1-13(2)9-11-18(22(3,20)21)12-10-16-15(19)17-14-7-5-4-6-8-14/h13-14H,4-12H2,1-3H3,(H2,16,17,19) |
| InChIKey | NNOLFGXPSRIQJT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |