C12H22ClNO2 — CID 106142571
N-(4-chloro-2,2-dimethylbutyl)oxane-2-carboxamide (PubChem CID 106142571) has the molecular formula C12H22ClNO2 and a molecular weight of 247.77 g/mol. Its IUPAC name is N-(4-chloro-2,2-dimethylbutyl)oxane-2-carboxamide.
| Compound Name | N-(4-chloro-2,2-dimethylbutyl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 106142571 |
| Molecular Formula | C12H22ClNO2 |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-(4-chloro-2,2-dimethylbutyl)oxane-2-carboxamide |
| SMILES | CC(C)(CCCl)CNC(=O)C1CCCCO1 |
| InChI | InChI=1S/C12H22ClNO2/c1-12(2,6-7-13)9-14-11(15)10-5-3-4-8-16-10/h10H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | GGYSPWUPPUSTOC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|