C12H21ClN2O3 — CID 108573698
N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]oxolane-2-carboxamide (PubChem CID 108573698) has the molecular formula C12H21ClN2O3 and a molecular weight of 276.76 g/mol. Its IUPAC name is N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 108573698 |
| Molecular Formula | C12H21ClN2O3 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]oxolane-2-carboxamide |
| SMILES | CC(C)(CCl)C(=O)NCCNC(=O)C1CCCO1 |
| InChI | InChI=1S/C12H21ClN2O3/c1-12(2,8-13)11(17)15-6-5-14-10(16)9-4-3-7-18-9/h9H,3-8H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | CBSWLZHTSXJZEU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|