C14H25ClN2O2 — CID 108571121
N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]cyclohexanecarboxamide (PubChem CID 108571121) has the molecular formula C14H25ClN2O2 and a molecular weight of 288.82 g/mol. Its IUPAC name is N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 108571121 |
| Molecular Formula | C14H25ClN2O2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]cyclohexanecarboxamide |
| SMILES | CC(C)(CCl)C(=O)NCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C14H25ClN2O2/c1-14(2,10-15)13(19)17-9-8-16-12(18)11-6-4-3-5-7-11/h11H,3-10H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | IBPKZGWRRREMJX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|