C13H24ClNO — CID 106009639
3-chloro-N-(3-cyclopentylpropyl)-2,2-dimethylpropanamide (PubChem CID 106009639) has the molecular formula C13H24ClNO and a molecular weight of 245.79 g/mol. Its IUPAC name is 3-chloro-N-(3-cyclopentylpropyl)-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-(3-cyclopentylpropyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106009639 |
| Molecular Formula | C13H24ClNO |
| Molecular Weight | 245.79 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 3-chloro-N-(3-cyclopentylpropyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NCCCC1CCCC1 |
| InChI | InChI=1S/C13H24ClNO/c1-13(2,10-14)12(16)15-9-5-8-11-6-3-4-7-11/h11H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | UDIYDAQLAHVQNM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.79 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|