C10H17ClF3NO — CID 115517695
3-chloro-2,2-dimethyl-N-(5,5,5-trifluoropentyl)propanamide (PubChem CID 115517695) has the molecular formula C10H17ClF3NO and a molecular weight of 259.70 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-(5,5,5-trifluoropentyl)propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-(5,5,5-trifluoropentyl)propanamide |
|---|---|
| PubChem CID | 115517695 |
| Molecular Formula | C10H17ClF3NO |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-(5,5,5-trifluoropentyl)propanamide |
| SMILES | CC(C)(CCl)C(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C10H17ClF3NO/c1-9(2,7-11)8(16)15-6-4-3-5-10(12,13)14/h3-7H2,1-2H3,(H,15,16) |
| InChIKey | QZSKUGMPVSHELM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|