C12H25ClN2O — CID 106033672
3-chloro-2,2-dimethyl-N-[3-[methyl(propan-2-yl)amino]propyl]propanamide (PubChem CID 106033672) has the molecular formula C12H25ClN2O and a molecular weight of 248.80 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[3-[methyl(propan-2-yl)amino]propyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[3-[methyl(propan-2-yl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 106033672 |
| Molecular Formula | C12H25ClN2O |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[3-[methyl(propan-2-yl)amino]propyl]propanamide |
| SMILES | CC(C)N(C)CCCNC(=O)C(C)(C)CCl |
| InChI | InChI=1S/C12H25ClN2O/c1-10(2)15(5)8-6-7-14-11(16)12(3,4)9-13/h10H,6-9H2,1-5H3,(H,14,16) |
| InChIKey | OYMBFRQMSKQOPK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|