C16H25ClN2O — CID 63679963
3-chloro-N-[3-(N-ethylanilino)propyl]-2,2-dimethylpropanamide (PubChem CID 63679963) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 3-chloro-N-[3-(N-ethylanilino)propyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[3-(N-ethylanilino)propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63679963 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-chloro-N-[3-(N-ethylanilino)propyl]-2,2-dimethylpropanamide |
| SMILES | CCN(CCCNC(=O)C(C)(C)CCl)c1ccccc1 |
| InChI | InChI=1S/C16H25ClN2O/c1-4-19(14-9-6-5-7-10-14)12-8-11-18-15(20)16(2,3)13-17/h5-7,9-10H,4,8,11-13H2,1-3H3,(H,18,20) |
| InChIKey | SBDQPJCCGXABRX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|