C16H27N3O — CID 61258840
(2S)-2-amino-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide (PubChem CID 61258840) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 61258840 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (2S)-2-amino-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide |
| SMILES | CCN(CCCNC(=O)[C@@H](N)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H27N3O/c1-4-19(14-9-6-5-7-10-14)12-8-11-18-16(20)15(17)13(2)3/h5-7,9-10,13,15H,4,8,11-12,17H2,1-3H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | OWTYOFZZTKRRCY-HNNXBMFYSA-N |
| XLogP | 2.00 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|