C19H34IN5O — CID 111390290
N-[2-[[N-[3-(N-ethylanilino)propyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111390290) has the molecular formula C19H34IN5O and a molecular weight of 475.42 g/mol. Its IUPAC name is N-[2-[[N-[3-(N-ethylanilino)propyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-[3-(N-ethylanilino)propyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111390290 |
| Molecular Formula | C19H34IN5O |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-[2-[[N-[3-(N-ethylanilino)propyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | CCN(CCCN/C(=N/C)NCCNC(=O)C(C)C)c1ccccc1.I |
| InChI | InChI=1S/C19H33N5O.HI/c1-5-24(17-10-7-6-8-11-17)15-9-12-22-19(20-4)23-14-13-21-18(25)16(2)3;/h6-8,10-11,16H,5,9,12-15H2,1-4H3,(H,21,25)(H2,20,22,23);1H |
| InChIKey | GBEXVWAGPVPHOU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|