C17H30N4O2S — CID 111390055
1-[3-(N-ethylanilino)propyl]-2-methyl-3-(3-methylsulfonylpropyl)guanidine (PubChem CID 111390055) has the molecular formula C17H30N4O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-[3-(N-ethylanilino)propyl]-2-methyl-3-(3-methylsulfonylpropyl)guanidine.
| Compound Name | 1-[3-(N-ethylanilino)propyl]-2-methyl-3-(3-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 111390055 |
| Molecular Formula | C17H30N4O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-[3-(N-ethylanilino)propyl]-2-methyl-3-(3-methylsulfonylpropyl)guanidine |
| SMILES | CCN(CCCN/C(=N/C)NCCCS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C17H30N4O2S/c1-4-21(16-10-6-5-7-11-16)14-8-12-19-17(18-2)20-13-9-15-24(3,22)23/h5-7,10-11H,4,8-9,12-15H2,1-3H3,(H2,18,19,20) |
| InChIKey | AVMPPRRDUHETFW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|