C15H30N2O — CID 113322317
2-(aminomethyl)-N-(3-cyclopentylpropyl)-2-ethylbutanamide (PubChem CID 113322317) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3-cyclopentylpropyl)-2-ethylbutanamide.
| Compound Name | 2-(aminomethyl)-N-(3-cyclopentylpropyl)-2-ethylbutanamide |
|---|---|
| PubChem CID | 113322317 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 2-(aminomethyl)-N-(3-cyclopentylpropyl)-2-ethylbutanamide |
| SMILES | CCC(CC)(CN)C(=O)NCCCC1CCCC1 |
| InChI | InChI=1S/C15H30N2O/c1-3-15(4-2,12-16)14(18)17-11-7-10-13-8-5-6-9-13/h13H,3-12,16H2,1-2H3,(H,17,18) |
| InChIKey | JPWWAGNVNIZIRI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|