C15H25NO3 — CID 106143749
2-ethoxy-4-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]phenol (PubChem CID 106143749) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-ethoxy-4-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]phenol.
| Compound Name | 2-ethoxy-4-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 106143749 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-ethoxy-4-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]phenol |
| SMILES | CCOc1cc(CNCC(C)(C)CCO)ccc1O |
| InChI | InChI=1S/C15H25NO3/c1-4-19-14-9-12(5-6-13(14)18)10-16-11-15(2,3)7-8-17/h5-6,9,16-18H,4,7-8,10-11H2,1-3H3 |
| InChIKey | QYMDKULHTSPPGR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |