C15H25NO2 — CID 64570279
4-[(2,3-dimethylbutylamino)methyl]-2-ethoxyphenol (PubChem CID 64570279) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-[(2,3-dimethylbutylamino)methyl]-2-ethoxyphenol.
| Compound Name | 4-[(2,3-dimethylbutylamino)methyl]-2-ethoxyphenol |
|---|---|
| PubChem CID | 64570279 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 4-[(2,3-dimethylbutylamino)methyl]-2-ethoxyphenol |
| SMILES | CCOc1cc(CNCC(C)C(C)C)ccc1O |
| InChI | InChI=1S/C15H25NO2/c1-5-18-15-8-13(6-7-14(15)17)10-16-9-12(4)11(2)3/h6-8,11-12,16-17H,5,9-10H2,1-4H3 |
| InChIKey | JGISWEAHNCXUBB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |