C17H21NO2S — CID 10614410
(1R,10S,11R)-8,10,11-trimethyl-13-oxo-11-prop-1-en-2-yl-13lambda4-thia-8-azatricyclo[8.2.1.02,7]trideca-2,4,6-trien-9-one (PubChem CID 10614410) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is (1R,10S,11R)-8,10,11-trimethyl-13-oxo-11-prop-1-en-2-yl-13lambda4-thia-8-azatricyclo[8.2.1.02,7]trideca-2,4,6-trien-9-one.
| Compound Name | (1R,10S,11R)-8,10,11-trimethyl-13-oxo-11-prop-1-en-2-yl-13lambda4-thia-8-azatricyclo[8.2.1.02,7]trideca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 10614410 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (1R,10S,11R)-8,10,11-trimethyl-13-oxo-11-prop-1-en-2-yl-13lambda4-thia-8-azatricyclo[8.2.1.02,7]trideca-2,4,6-trien-9-one |
| SMILES | C=C(C)[C@@]1(C)CC2c3ccccc3N(C)C(=O)[C@@]1(C)S2=O |
| InChI | InChI=1S/C17H21NO2S/c1-11(2)16(3)10-14-12-8-6-7-9-13(12)18(5)15(19)17(16,4)21(14)20/h6-9,14H,1,10H2,2-5H3/t14?,16-,17-,21?/m1/s1 |
| InChIKey | SANUYLDNINCJMO-ABLWEVDZSA-N |
| XLogP | 3.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|