C16H24N2O — CID 106144224
5-(1H-indol-5-ylmethylamino)-4,4-dimethylpentan-1-ol (PubChem CID 106144224) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-(1H-indol-5-ylmethylamino)-4,4-dimethylpentan-1-ol.
| Compound Name | 5-(1H-indol-5-ylmethylamino)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106144224 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-(1H-indol-5-ylmethylamino)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNCc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C16H24N2O/c1-16(2,7-3-9-19)12-17-11-13-4-5-15-14(10-13)6-8-18-15/h4-6,8,10,17-19H,3,7,9,11-12H2,1-2H3 |
| InChIKey | YXDVGNBYMBQQQB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |