C18H39NO — CID 106144836
4,4-dimethyl-5-(undecan-6-ylamino)pentan-1-ol (PubChem CID 106144836) has the molecular formula C18H39NO and a molecular weight of 285.52 g/mol. Its IUPAC name is 4,4-dimethyl-5-(undecan-6-ylamino)pentan-1-ol.
| Compound Name | 4,4-dimethyl-5-(undecan-6-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106144836 |
| Molecular Formula | C18H39NO |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.30 |
| IUPAC Name | 4,4-dimethyl-5-(undecan-6-ylamino)pentan-1-ol |
| SMILES | CCCCCC(CCCCC)NCC(C)(C)CCCO |
| InChI | InChI=1S/C18H39NO/c1-5-7-9-12-17(13-10-8-6-2)19-16-18(3,4)14-11-15-20/h17,19-20H,5-16H2,1-4H3 |
| InChIKey | ABYXSWQWSXOCSP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|