C12H24F3N — CID 126694483
2,2-dimethyl-N-(1,1,1-trifluoropropan-2-yl)heptan-1-amine (PubChem CID 126694483) has the molecular formula C12H24F3N and a molecular weight of 239.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-(1,1,1-trifluoropropan-2-yl)heptan-1-amine.
| Compound Name | 2,2-dimethyl-N-(1,1,1-trifluoropropan-2-yl)heptan-1-amine |
|---|---|
| PubChem CID | 126694483 |
| Molecular Formula | C12H24F3N |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 2,2-dimethyl-N-(1,1,1-trifluoropropan-2-yl)heptan-1-amine |
| SMILES | CCCCCC(C)(C)CNC(C)C(F)(F)F |
| InChI | InChI=1S/C12H24F3N/c1-5-6-7-8-11(3,4)9-16-10(2)12(13,14)15/h10,16H,5-9H2,1-4H3 |
| InChIKey | FGCLCVIXLWHEOY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|