C14H26BrNO2 — CID 106145015
N-(5-bromo-2,2-dimethylpentyl)-2-(1-methoxycyclobutyl)acetamide (PubChem CID 106145015) has the molecular formula C14H26BrNO2 and a molecular weight of 320.27 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-2-(1-methoxycyclobutyl)acetamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-2-(1-methoxycyclobutyl)acetamide |
|---|---|
| PubChem CID | 106145015 |
| Molecular Formula | C14H26BrNO2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-2-(1-methoxycyclobutyl)acetamide |
| SMILES | COC1(CC(=O)NCC(C)(C)CCCBr)CCC1 |
| InChI | InChI=1S/C14H26BrNO2/c1-13(2,6-5-9-15)11-16-12(17)10-14(18-3)7-4-8-14/h4-11H2,1-3H3,(H,16,17) |
| InChIKey | AQLYSJBQDPDGJG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|