C15H17BrN2 — CID 10614502
1-benzyl-3-(bromomethyl)-4,5,6,7-tetrahydroindazole (PubChem CID 10614502) has the molecular formula C15H17BrN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 1-benzyl-3-(bromomethyl)-4,5,6,7-tetrahydroindazole.
| Compound Name | 1-benzyl-3-(bromomethyl)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 10614502 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1-benzyl-3-(bromomethyl)-4,5,6,7-tetrahydroindazole |
| SMILES | BrCc1nn(Cc2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C15H17BrN2/c16-10-14-13-8-4-5-9-15(13)18(17-14)11-12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-11H2 |
| InChIKey | LODZHRHDZNNKIB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|