C11H24N2O3 — CID 106146261
1-(3,3-dimethoxyazetidin-1-yl)-3-(dimethylamino)-2-methylpropan-2-ol (PubChem CID 106146261) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-(3,3-dimethoxyazetidin-1-yl)-3-(dimethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-(3,3-dimethoxyazetidin-1-yl)-3-(dimethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106146261 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-(3,3-dimethoxyazetidin-1-yl)-3-(dimethylamino)-2-methylpropan-2-ol |
| SMILES | COC1(OC)CN(CC(C)(O)CN(C)C)C1 |
| InChI | InChI=1S/C11H24N2O3/c1-10(14,6-12(2)3)7-13-8-11(9-13,15-4)16-5/h14H,6-9H2,1-5H3 |
| InChIKey | CYGQBJVIHNWTFI-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|