C12H25NO3 — CID 106353639
3-(3,3-dimethoxyazetidin-1-yl)-4,4-dimethylpentan-1-ol (PubChem CID 106353639) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-(3,3-dimethoxyazetidin-1-yl)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-(3,3-dimethoxyazetidin-1-yl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106353639 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 3-(3,3-dimethoxyazetidin-1-yl)-4,4-dimethylpentan-1-ol |
| SMILES | COC1(OC)CN(C(CCO)C(C)(C)C)C1 |
| InChI | InChI=1S/C12H25NO3/c1-11(2,3)10(6-7-14)13-8-12(9-13,15-4)16-5/h10,14H,6-9H2,1-5H3 |
| InChIKey | HHVSJBMUFHWPSN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|