C13H23NO — CID 106353576
3-(2,5-dimethylpyrrol-1-yl)-4,4-dimethylpentan-1-ol (PubChem CID 106353576) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106353576 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)-4,4-dimethylpentan-1-ol |
| SMILES | Cc1ccc(C)n1C(CCO)C(C)(C)C |
| InChI | InChI=1S/C13H23NO/c1-10-6-7-11(2)14(10)12(8-9-15)13(3,4)5/h6-7,12,15H,8-9H2,1-5H3 |
| InChIKey | BQGNWXXALSAAAP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |