C9H19F3N2OS — CID 106147811
1-(dimethylamino)-2-methyl-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol (PubChem CID 106147811) has the molecular formula C9H19F3N2OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 1-(dimethylamino)-2-methyl-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol.
| Compound Name | 1-(dimethylamino)-2-methyl-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 106147811 |
| Molecular Formula | C9H19F3N2OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(dimethylamino)-2-methyl-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol |
| SMILES | CN(C)CC(C)(O)CNCCSC(F)(F)F |
| InChI | InChI=1S/C9H19F3N2OS/c1-8(15,7-14(2)3)6-13-4-5-16-9(10,11)12/h13,15H,4-7H2,1-3H3 |
| InChIKey | YABHQPRWVWGETJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|