C9H18F3NOS — CID 106190171
2,3-dimethyl-3-[2-(trifluoromethylsulfanyl)ethylamino]butan-2-ol (PubChem CID 106190171) has the molecular formula C9H18F3NOS and a molecular weight of 245.31 g/mol. Its IUPAC name is 2,3-dimethyl-3-[2-(trifluoromethylsulfanyl)ethylamino]butan-2-ol.
| Compound Name | 2,3-dimethyl-3-[2-(trifluoromethylsulfanyl)ethylamino]butan-2-ol |
|---|---|
| PubChem CID | 106190171 |
| Molecular Formula | C9H18F3NOS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2,3-dimethyl-3-[2-(trifluoromethylsulfanyl)ethylamino]butan-2-ol |
| SMILES | CC(C)(O)C(C)(C)NCCSC(F)(F)F |
| InChI | InChI=1S/C9H18F3NOS/c1-7(2,8(3,4)14)13-5-6-15-9(10,11)12/h13-14H,5-6H2,1-4H3 |
| InChIKey | GWERLOQXRKNJFV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|