C15H31N3O2 — CID 106148531
N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methyl-2-piperidin-3-ylpropanamide (PubChem CID 106148531) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methyl-2-piperidin-3-ylpropanamide.
| Compound Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methyl-2-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 106148531 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methyl-2-piperidin-3-ylpropanamide |
| SMILES | CN(C)CC(C)(O)CNC(=O)C(C)(C)C1CCCNC1 |
| InChI | InChI=1S/C15H31N3O2/c1-14(2,12-7-6-8-16-9-12)13(19)17-10-15(3,20)11-18(4)5/h12,16,20H,6-11H2,1-5H3,(H,17,19) |
| InChIKey | SIWLCEQFHZUJLG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |