C11H23N3O — CID 83199911
N',N',2-trimethyl-2-piperidin-3-ylpropanehydrazide (PubChem CID 83199911) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is N',N',2-trimethyl-2-piperidin-3-ylpropanehydrazide.
| Compound Name | N',N',2-trimethyl-2-piperidin-3-ylpropanehydrazide |
|---|---|
| PubChem CID | 83199911 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | N',N',2-trimethyl-2-piperidin-3-ylpropanehydrazide |
| SMILES | CN(C)NC(=O)C(C)(C)C1CCCNC1 |
| InChI | InChI=1S/C11H23N3O/c1-11(2,10(15)13-14(3)4)9-6-5-7-12-8-9/h9,12H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | KGAIDOULVMFQBC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|