C15H20N2O3 — CID 106149250
1-(5-hydroxy-2,2-dimethylpentyl)benzimidazole-4-carboxylic acid (PubChem CID 106149250) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-(5-hydroxy-2,2-dimethylpentyl)benzimidazole-4-carboxylic acid.
| Compound Name | 1-(5-hydroxy-2,2-dimethylpentyl)benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106149250 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-(5-hydroxy-2,2-dimethylpentyl)benzimidazole-4-carboxylic acid |
| SMILES | CC(C)(CCCO)Cn1cnc2c(C(=O)O)cccc21 |
| InChI | InChI=1S/C15H20N2O3/c1-15(2,7-4-8-18)9-17-10-16-13-11(14(19)20)5-3-6-12(13)17/h3,5-6,10,18H,4,7-9H2,1-2H3,(H,19,20) |
| InChIKey | OKTXIORLKNVXOP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |