C15H17N3O2 — CID 106151815
1-(3-cyanobenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106151815) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-(3-cyanobenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-(3-cyanobenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106151815 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-(3-cyanobenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(C(=O)c2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C15H17N3O2/c1-15(14(20)17-2)6-7-18(10-15)13(19)12-5-3-4-11(8-12)9-16/h3-5,8H,6-7,10H2,1-2H3,(H,17,20) |
| InChIKey | KPYHEESZTJIVIN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |