C14H18N2O4 — CID 106151768
1-(2,4-dihydroxybenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106151768) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-(2,4-dihydroxybenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2,4-dihydroxybenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106151768 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-(2,4-dihydroxybenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(C(=O)c2ccc(O)cc2O)C1 |
| InChI | InChI=1S/C14H18N2O4/c1-14(13(20)15-2)5-6-16(8-14)12(19)10-4-3-9(17)7-11(10)18/h3-4,7,17-18H,5-6,8H2,1-2H3,(H,15,20) |
| InChIKey | UIVJYISBSBAPRJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |