C14H18BrN3O2 — CID 106317517
1-(3-amino-2-bromobenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106317517) has the molecular formula C14H18BrN3O2 and a molecular weight of 340.22 g/mol. Its IUPAC name is 1-(3-amino-2-bromobenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-(3-amino-2-bromobenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106317517 |
| Molecular Formula | C14H18BrN3O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1-(3-amino-2-bromobenzoyl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(C(=O)c2cccc(N)c2Br)C1 |
| InChI | InChI=1S/C14H18BrN3O2/c1-14(13(20)17-2)6-7-18(8-14)12(19)9-4-3-5-10(16)11(9)15/h3-5H,6-8,16H2,1-2H3,(H,17,20) |
| InChIKey | VUSGKSDQUMIFEM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|