C15H19BrN2OS — CID 107982295
1-(2-bromo-3-methylbenzoyl)-4-methylpiperidine-4-carbothioamide (PubChem CID 107982295) has the molecular formula C15H19BrN2OS and a molecular weight of 355.30 g/mol. Its IUPAC name is 1-(2-bromo-3-methylbenzoyl)-4-methylpiperidine-4-carbothioamide.
| Compound Name | 1-(2-bromo-3-methylbenzoyl)-4-methylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 107982295 |
| Molecular Formula | C15H19BrN2OS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1-(2-bromo-3-methylbenzoyl)-4-methylpiperidine-4-carbothioamide |
| SMILES | Cc1cccc(C(=O)N2CCC(C)(C(N)=S)CC2)c1Br |
| InChI | InChI=1S/C15H19BrN2OS/c1-10-4-3-5-11(12(10)16)13(19)18-8-6-15(2,7-9-18)14(17)20/h3-5H,6-9H2,1-2H3,(H2,17,20) |
| InChIKey | MWIGBHAZWPRVCV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|