C13H20N4OS — CID 107161004
1-(1,3-dimethylpyrazole-4-carbonyl)-4-methylpiperidine-4-carbothioamide (PubChem CID 107161004) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazole-4-carbonyl)-4-methylpiperidine-4-carbothioamide.
| Compound Name | 1-(1,3-dimethylpyrazole-4-carbonyl)-4-methylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 107161004 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-(1,3-dimethylpyrazole-4-carbonyl)-4-methylpiperidine-4-carbothioamide |
| SMILES | Cc1nn(C)cc1C(=O)N1CCC(C)(C(N)=S)CC1 |
| InChI | InChI=1S/C13H20N4OS/c1-9-10(8-16(3)15-9)11(18)17-6-4-13(2,5-7-17)12(14)19/h8H,4-7H2,1-3H3,(H2,14,19) |
| InChIKey | VPEUQZKCTMWVCI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|