C8H19N3O2 — CID 106153654
1-(4-amino-1-methoxybutan-2-yl)-3-ethylurea (PubChem CID 106153654) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(4-amino-1-methoxybutan-2-yl)-3-ethylurea.
| Compound Name | 1-(4-amino-1-methoxybutan-2-yl)-3-ethylurea |
|---|---|
| PubChem CID | 106153654 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-(4-amino-1-methoxybutan-2-yl)-3-ethylurea |
| SMILES | CCNC(=O)NC(CCN)COC |
| InChI | InChI=1S/C8H19N3O2/c1-3-10-8(12)11-7(4-5-9)6-13-2/h7H,3-6,9H2,1-2H3,(H2,10,11,12) |
| InChIKey | WVHGCNMFTHPIFT-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |