C13H22N2O2 — CID 106154653
5-(2-amino-3-methoxyanilino)-2-methylpentan-1-ol (PubChem CID 106154653) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 5-(2-amino-3-methoxyanilino)-2-methylpentan-1-ol.
| Compound Name | 5-(2-amino-3-methoxyanilino)-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 106154653 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 5-(2-amino-3-methoxyanilino)-2-methylpentan-1-ol |
| SMILES | COc1cccc(NCCCC(C)CO)c1N |
| InChI | InChI=1S/C13H22N2O2/c1-10(9-16)5-4-8-15-11-6-3-7-12(17-2)13(11)14/h3,6-7,10,15-16H,4-5,8-9,14H2,1-2H3 |
| InChIKey | RBWSWODDRQBOFE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|