C13H23N3O3S — CID 106154742
4-[(4-amino-1-methoxybutan-2-yl)amino]-N-ethylbenzenesulfonamide (PubChem CID 106154742) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-[(4-amino-1-methoxybutan-2-yl)amino]-N-ethylbenzenesulfonamide.
| Compound Name | 4-[(4-amino-1-methoxybutan-2-yl)amino]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106154742 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-[(4-amino-1-methoxybutan-2-yl)amino]-N-ethylbenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(NC(CCN)COC)cc1 |
| InChI | InChI=1S/C13H23N3O3S/c1-3-15-20(17,18)13-6-4-11(5-7-13)16-12(8-9-14)10-19-2/h4-7,12,15-16H,3,8-10,14H2,1-2H3 |
| InChIKey | MVVXICSCJLSOPO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |