C14H19BrClNO3 — CID 106156353
N-(4-bromo-1-methoxybutan-2-yl)-2-(3-chlorophenoxy)propanamide (PubChem CID 106156353) has the molecular formula C14H19BrClNO3 and a molecular weight of 364.67 g/mol. Its IUPAC name is N-(4-bromo-1-methoxybutan-2-yl)-2-(3-chlorophenoxy)propanamide.
| Compound Name | N-(4-bromo-1-methoxybutan-2-yl)-2-(3-chlorophenoxy)propanamide |
|---|---|
| PubChem CID | 106156353 |
| Molecular Formula | C14H19BrClNO3 |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | N-(4-bromo-1-methoxybutan-2-yl)-2-(3-chlorophenoxy)propanamide |
| SMILES | COCC(CCBr)NC(=O)C(C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H19BrClNO3/c1-10(20-13-5-3-4-11(16)8-13)14(18)17-12(6-7-15)9-19-2/h3-5,8,10,12H,6-7,9H2,1-2H3,(H,17,18) |
| InChIKey | VBZSAIYYHMJXBF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|