C11H25NO3 — CID 106158376
5-(1,1-dimethoxypropan-2-ylamino)-2-methylpentan-1-ol (PubChem CID 106158376) has the molecular formula C11H25NO3 and a molecular weight of 219.32 g/mol. Its IUPAC name is 5-(1,1-dimethoxypropan-2-ylamino)-2-methylpentan-1-ol.
| Compound Name | 5-(1,1-dimethoxypropan-2-ylamino)-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 106158376 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 5-(1,1-dimethoxypropan-2-ylamino)-2-methylpentan-1-ol |
| SMILES | COC(OC)C(C)NCCCC(C)CO |
| InChI | InChI=1S/C11H25NO3/c1-9(8-13)6-5-7-12-10(2)11(14-3)15-4/h9-13H,5-8H2,1-4H3 |
| InChIKey | AVMXUIPFVVQPEN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|