C13H19BrClNOS — CID 106159083
3-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-methylsulfanylbutan-1-ol (PubChem CID 106159083) has the molecular formula C13H19BrClNOS and a molecular weight of 352.73 g/mol. Its IUPAC name is 3-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106159083 |
| Molecular Formula | C13H19BrClNOS |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 3-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)NC(C)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H19BrClNOS/c1-8(16-9(2)13(7-17)18-3)11-5-4-10(14)6-12(11)15/h4-6,8-9,13,16-17H,7H2,1-3H3 |
| InChIKey | IXJHIUNTBJOACT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |