C15H25NO4 — CID 106159175
2-(4-hydroxy-1-methoxybutan-2-yl)-2-azaspiro[4.6]undecane-1,3-dione (PubChem CID 106159175) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(4-hydroxy-1-methoxybutan-2-yl)-2-azaspiro[4.6]undecane-1,3-dione.
| Compound Name | 2-(4-hydroxy-1-methoxybutan-2-yl)-2-azaspiro[4.6]undecane-1,3-dione |
|---|---|
| PubChem CID | 106159175 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-(4-hydroxy-1-methoxybutan-2-yl)-2-azaspiro[4.6]undecane-1,3-dione |
| SMILES | COCC(CCO)N1C(=O)CC2(CCCCCC2)C1=O |
| InChI | InChI=1S/C15H25NO4/c1-20-11-12(6-9-17)16-13(18)10-15(14(16)19)7-4-2-3-5-8-15/h12,17H,2-11H2,1H3 |
| InChIKey | YPUOQPVOMYAAOE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|