C10H20N2O3S — CID 106161513
3-amino-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)oxolane-3-carboxamide (PubChem CID 106161513) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-amino-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)oxolane-3-carboxamide.
| Compound Name | 3-amino-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 106161513 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-amino-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)oxolane-3-carboxamide |
| SMILES | CSC(CO)C(C)NC(=O)C1(N)CCOC1 |
| InChI | InChI=1S/C10H20N2O3S/c1-7(8(5-13)16-2)12-9(14)10(11)3-4-15-6-10/h7-8,13H,3-6,11H2,1-2H3,(H,12,14) |
| InChIKey | UEIRFRWJYWSBGX-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |