C15H20O8 — CID 10616238
[(1R,5R,6S,7R)-5,6,7-triacetyloxycyclohept-3-en-1-yl] acetate (PubChem CID 10616238) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is [(1R,5R,6S,7R)-5,6,7-triacetyloxycyclohept-3-en-1-yl] acetate.
| Compound Name | [(1R,5R,6S,7R)-5,6,7-triacetyloxycyclohept-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 10616238 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(1R,5R,6S,7R)-5,6,7-triacetyloxycyclohept-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)CC=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H20O8/c1-8(16)20-12-6-5-7-13(21-9(2)17)15(23-11(4)19)14(12)22-10(3)18/h5-6,12-15H,7H2,1-4H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | CVMROLROAFZEOV-APIJFGDWSA-N |
| XLogP | 0.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|