C21H24LiNO2 — CID 10616333
lithium N-(2-hydroxyethyl)-2-methanidyl-N-(1-phenylcyclopentyl)benzamide (PubChem CID 10616333) has the molecular formula C21H24LiNO2 and a molecular weight of 329.37 g/mol. Its IUPAC name is lithium N-(2-hydroxyethyl)-2-methanidyl-N-(1-phenylcyclopentyl)benzamide.
| Compound Name | lithium N-(2-hydroxyethyl)-2-methanidyl-N-(1-phenylcyclopentyl)benzamide |
|---|---|
| PubChem CID | 10616333 |
| Molecular Formula | C21H24LiNO2 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | lithium N-(2-hydroxyethyl)-2-methanidyl-N-(1-phenylcyclopentyl)benzamide |
| SMILES | [CH2-]c1ccccc1C(=O)N(CCO)C1(c2ccccc2)CCCC1.[Li+] |
| InChI | InChI=1S/C21H24NO2.Li/c1-17-9-5-6-12-19(17)20(24)22(15-16-23)21(13-7-8-14-21)18-10-3-2-4-11-18;/h2-6,9-12,23H,1,7-8,13-16H2;/q-1;+1 |
| InChIKey | SJTXZVBGGMSAGV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|