C18H26N2O4 — CID 3749480
N',N'-bis(2-hydroxyethyl)-N-[(1-phenylcyclopentyl)methyl]oxamide (PubChem CID 3749480) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N',N'-bis(2-hydroxyethyl)-N-[(1-phenylcyclopentyl)methyl]oxamide.
| Compound Name | N',N'-bis(2-hydroxyethyl)-N-[(1-phenylcyclopentyl)methyl]oxamide |
|---|---|
| PubChem CID | 3749480 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N',N'-bis(2-hydroxyethyl)-N-[(1-phenylcyclopentyl)methyl]oxamide |
| SMILES | O=C(NCC1(c2ccccc2)CCCC1)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C18H26N2O4/c21-12-10-20(11-13-22)17(24)16(23)19-14-18(8-4-5-9-18)15-6-2-1-3-7-15/h1-3,6-7,21-22H,4-5,8-14H2,(H,19,23) |
| InChIKey | RDJGWIRNEQKUFV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|