C10H16F3N5OS — CID 106163726
3-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-methylsulfanylbutan-1-ol (PubChem CID 106163726) has the molecular formula C10H16F3N5OS and a molecular weight of 311.33 g/mol. Its IUPAC name is 3-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106163726 |
| Molecular Formula | C10H16F3N5OS |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 3-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)Nc1cc(NN)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H16F3N5OS/c1-5(6(4-19)20-2)15-7-3-8(18-14)17-9(16-7)10(11,12)13/h3,5-6,19H,4,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | MEIAHYTUASDHEP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|