C10H15F3N6O — CID 106775480
2-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide (PubChem CID 106775480) has the molecular formula C10H15F3N6O and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide.
| Compound Name | 2-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 106775480 |
| Molecular Formula | C10H15F3N6O |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide |
| SMILES | CC(Nc1cc(NN)nc(C(F)(F)F)n1)C(=O)N(C)C |
| InChI | InChI=1S/C10H15F3N6O/c1-5(8(20)19(2)3)15-6-4-7(18-14)17-9(16-6)10(11,12)13/h4-5H,14H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | NUAMQIZGOBRJQL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|