C11H16F3N5O — CID 106773392
2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N-ethyl-N-methylpropanamide (PubChem CID 106773392) has the molecular formula C11H16F3N5O and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N-ethyl-N-methylpropanamide.
| Compound Name | 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 106773392 |
| Molecular Formula | C11H16F3N5O |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)Nc1cc(N)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N5O/c1-4-19(3)9(20)6(2)16-8-5-7(15)17-10(18-8)11(12,13)14/h5-6H,4H2,1-3H3,(H3,15,16,17,18) |
| InChIKey | AIAAIYZPSIWCBF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |