C12H22N6O — CID 80946866
2-[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]-N,N-dimethylpropanamide (PubChem CID 80946866) has the molecular formula C12H22N6O and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]-N,N-dimethylpropanamide.
| Compound Name | 2-[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 80946866 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]-N,N-dimethylpropanamide |
| SMILES | CCCc1nc(NN)cc(NC(C)C(=O)N(C)C)n1 |
| InChI | InChI=1S/C12H22N6O/c1-5-6-9-15-10(7-11(16-9)17-13)14-8(2)12(19)18(3)4/h7-8H,5-6,13H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | AUOVELKCVXLSAU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|